cas: 33070-04-1 — see every product listed under this CAS number, including other names
2,3-Dihydrobenzo[b][1,4]dioxine-2-carboxamide, 97%, 97% (CAS 33070-04-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CUKZ-1g |
| cas | 33070-04-1 |
| size | 1g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 366.80 Pln | |
| Chemat | 5g | 976.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3-dihydro-1,4-benzodioxine-3-carboxamide (CAS 33070-04-1) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 2,3-dihydro-1,4-benzodioxine-3-carboxamide. InChIKey: LIQWNOWUUZXEPC-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| InChIKey | LIQWNOWUUZXEPC-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)N |
Computed by PubChem (NCBI)