cas: 60788-02-5 — see every product listed under this CAS number, including other names
2-((2,5-Dioxo-1-phenylpyrrolidin-3-yl)thio)acetic acid, 95+% (CAS 60788-02-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A792520-10g |
| cas | 60788-02-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid (CAS 60788-02-5) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid. InChIKey: YTNPLWOAHMUJEA-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 2-(2,5-dioxo-1-phenylpyrrolidin-3-yl)sulfanylacetic acid |
| InChIKey | YTNPLWOAHMUJEA-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)N(C1=O)C2=CC=CC=C2)SCC(=O)O |
Computed by PubChem (NCBI)