CAS 1094395-81-9 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(3,4-Dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid (CAS 1094395-81-9) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid. InChIKey: LWZHJMGFTOIBBW-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | LWZHJMGFTOIBBW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC=C(S2)C(=O)O)OC |
Computed by PubChem (NCBI)