Products 91570-07-9
CAS 91570-07-9 appears in our catalog under these names: 3-(((1,3-Dioxoisoindolin-2-yl)methyl)thio)propanoic acid, 98%, 3-(N-Phthalimidoylmethylthio)propanoic acid. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]propanoic acid (CAS 91570-07-9) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: 3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]propanoic acid. InChIKey: VXLPEUWULMMAAI-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 3-[(1,3-dioxoisoindol-2-yl)methylsulfanyl]propanoic acid |
| InChIKey | VXLPEUWULMMAAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CSCCC(=O)O |
Computed by PubChem (NCBI)