CAS 1055980-74-9 is the registry number for (5Z)-5-(3-Ethoxy-4-hydroxybenzylidene)-1,3-thiazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 1055980-74-9) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: (5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: HTFKYUIYCWNLNL-POHAHGRESA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | (5Z)-5-[(3-ethoxy-4-hydroxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | HTFKYUIYCWNLNL-POHAHGRESA-N |
| SMILES | CCOC1=C(C=CC(=C1)/C=C\2/C(=O)NC(=O)S2)O |
Computed by PubChem (NCBI)