CAS 875164-17-3 appears in our catalog under these names: 3-Methanesulfonamidonaphthalene-2-carboxylic acid, 3-Methanesulfonamidonaphthalene-2-carboxylic acid, 95%, 3-[(Methylsulfonyl)amino]-2-naphthoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg, 100mg.
3-(methanesulfonamido)naphthalene-2-carboxylic acid (CAS 875164-17-3) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: 3-(methanesulfonamido)naphthalene-2-carboxylic acid. InChIKey: UMBRMWDSYIPKFV-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 3-(methanesulfonamido)naphthalene-2-carboxylic acid |
| InChIKey | UMBRMWDSYIPKFV-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC2=CC=CC=C2C=C1C(=O)O |
Computed by PubChem (NCBI)