CAS 2808410-66-2 is the registry number for 4-Ethynyl-4-methyl-1-(methylsulfonyl)-1,4-dihydro-2H-benzo[d][1,3]oxazin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethynyl-4-methyl-1-methylsulfonyl-3,1-benzoxazin-2-one (CAS 2808410-66-2) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: 4-ethynyl-4-methyl-1-methylsulfonyl-3,1-benzoxazin-2-one. InChIKey: WDOVKPJBCLWLGB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 4-ethynyl-4-methyl-1-methylsulfonyl-3,1-benzoxazin-2-one |
| InChIKey | WDOVKPJBCLWLGB-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C(=O)O1)S(=O)(=O)C)C#C |
Computed by PubChem (NCBI)