CAS 106058-86-0 appears in our catalog under these names: N-Tosyl-3-pyrrolecarboxylic acid, 96%, N–Tosyl–3–pyrrolecarboxylic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 5g, 100g, 1g.
1-(4-methylphenyl)sulfonylpyrrole-3-carboxylic acid (CAS 106058-86-0) is a chemical compound with the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylpyrrole-3-carboxylic acid. InChIKey: UYHPMGMXSFLPOF-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylpyrrole-3-carboxylic acid |
| InChIKey | UYHPMGMXSFLPOF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)