cas: 225641-94-1 — see every product listed under this CAS number, including other names
2-((3,4-Difluorophenyl)amino)acetic acid, 97%, 97% (CAS 225641-94-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFGA-100mg |
| cas | 225641-94-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 222.80 Pln | |
| Chemat | 250mg | 328.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-amino-2-(3,4-difluorophenyl)acetic acid (CAS 225641-94-1) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: 2-amino-2-(3,4-difluorophenyl)acetic acid. InChIKey: MPMRMNOQJFWMMA-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | 2-amino-2-(3,4-difluorophenyl)acetic acid |
| InChIKey | MPMRMNOQJFWMMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(C(=O)O)N)F)F |
Computed by PubChem (NCBI)