CAS 84832-02-0 appears in our catalog under these names: Methyl 3-amino-2,6-difluorobenzoate, 97%, Methyl 3–amino–2,6–difluorobenzoate, Methyl 3-Amino-2,6-Difluorobenzoate, 98%, 98%, METHYL 3-AMINO-2,6-DIFLUOROBENZOATE, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 50g.
Methyl 3-amino-2,6-difluorobenzoate (CAS 84832-02-0) is a chemical compound with the molecular formula C8H7F2NO2 and a molecular weight of 187.14 g/mol. IUPAC name: methyl 3-amino-2,6-difluorobenzoate. InChIKey: IUXHGFLADBGDTR-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO2 |
|---|---|
| Molecular weight | 187.14 g/mol |
| IUPAC name | methyl 3-amino-2,6-difluorobenzoate |
| InChIKey | IUXHGFLADBGDTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)N)F |
Computed by PubChem (NCBI)