cas: 1408074-43-0 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-2-(oxetan-3-yl)acetic acid, 95%, 95% (CAS 1408074-43-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112CTG-100mg |
| cas | 1408074-43-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 554.00 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 500mg | 1178.00 Pln | |
| Chemat | 1g | 1595.60 Pln | |
| Chemat | 5g | 5632.40 Pln | |
| Chemat | 10g | 9347.60 Pln | |
| Chemat | 25g | 18630.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid (CAS 1408074-43-0) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid. InChIKey: ZGLWUVSYEVUTKH-UHFFFAOYSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid |
| InChIKey | ZGLWUVSYEVUTKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1COC1)C(=O)O |
Computed by PubChem (NCBI)