CAS 1889289-71-7 appears in our catalog under these names: (R)-2-((tert-Butoxycarbonyl)amino)-2-(oxetan-3-yl)acetic acid, 95%, (2R)-2-{((tert-butoxy)carbonyl)amino}-2-(oxetan-3-yl)acetic acid, 97%, (R)–2–((tert–Butoxycarbonyl)amino)–2–(oxetan–3–yl)acetic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid (CAS 1889289-71-7) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid. InChIKey: ZGLWUVSYEVUTKH-SSDOTTSWSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid |
| InChIKey | ZGLWUVSYEVUTKH-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C1COC1)C(=O)O |
Computed by PubChem (NCBI)