CAS 1932299-93-8 appears in our catalog under these names: (2S)-2-{((tert-butoxy)carbonyl)amino}-2-(oxetan-3-yl)acetic acid, 95%, (S)-2-((t-Butoxycarbonyl)amino)-2-(oxetan-3-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 100mg, 1g, 5g, 10g, 50mg, 25mg, 500mg, 250mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid (CAS 1932299-93-8) is a chemical compound with the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid. InChIKey: ZGLWUVSYEVUTKH-ZETCQYMHSA-N.
| Molecular formula | C10H17NO5 |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(oxetan-3-yl)acetic acid |
| InChIKey | ZGLWUVSYEVUTKH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1COC1)C(=O)O |
Computed by PubChem (NCBI)