cas: 142847-18-5 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-3-(4-hydroxyphenyl)propanoic acid, 95%, 95% (CAS 142847-18-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11AODV-10g |
| cas | 142847-18-5 |
| size | 10g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 237.20 Pln | |
| Chemat | 25g | 414.80 Pln | |
| Chemat | 100g | 1005.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 142847-18-5) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CNBUSIJNWNXLQQ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CNBUSIJNWNXLQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)