CAS 87713-11-9 appears in our catalog under these names: (tert-Butoxycarbonyl)-L-tyrosine-15N, 98%, Boc-(15N)Tyr-OH. Offered by: Chemat Brand, Creative Peptides. Available pack sizes: on request, 100mg, 250mg, 1g.
3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 87713-11-9) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: 3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CNBUSIJNWNXLQQ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | 3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CNBUSIJNWNXLQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)