CAS 70642-86-3 appears in our catalog under these names: N-Boc-D-tyrosine, >95% (HPLC), Boc-D-Tyr-OH, 97%, Boc–D–Tyr–OH, Boc-D-Tyr-OH, N-(tert-Butoxycarbonyl)-D-tyrosine, >98.0%(HPLC)(T). Offered by: TRC, AmBeed, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 50g, 250mg, 5 g.
(2R)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 70642-86-3) is a chemical compound with the molecular formula C14H19NO5 and a molecular weight of 281.30 g/mol. IUPAC name: (2R)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CNBUSIJNWNXLQQ-LLVKDONJSA-N.
| Molecular formula | C14H19NO5 |
|---|---|
| Molecular weight | 281.30 g/mol |
| IUPAC name | (2R)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CNBUSIJNWNXLQQ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)