cas: 616224-61-4 — see every product listed under this CAS number, including other names
2-((tert-Butoxycarbonyl)amino)-6-chlorobenzoic acid, 95+% (CAS 616224-61-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A656606-10g |
| cas | 616224-61-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17842.30 Pln | |
| AmBeed | 5g | 11495.05 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 616224-61-4) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: HARNMVXJVFLAIJ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | HARNMVXJVFLAIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)