CAS 616224-61-4 appears in our catalog under these names: Boc-2-amino-6-chlorobenzoic acid, 95%, 2-((tert-Butoxycarbonyl)amino)-6-chlorobenzoic acid, 95+%, Boc-2-amino-6-chlorobenzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 2,5g.
2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 616224-61-4) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: HARNMVXJVFLAIJ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 2-chloro-6-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | HARNMVXJVFLAIJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)