CAS 379229-84-2 appears in our catalog under these names: tert-Butyl (5-chloro-1,3-benzodioxol-4-yl)carbamate, 95%, TERT–BUTYL (5–CHLORO–1,3–BENZODIOXOL–4–YL)CARBAMATE. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 200mg.
Tert-butyl N-(5-chloro-1,3-benzodioxol-4-yl)carbamate (CAS 379229-84-2) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: tert-butyl N-(5-chloro-1,3-benzodioxol-4-yl)carbamate. InChIKey: VGAUUGYGFROFEI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | tert-butyl N-(5-chloro-1,3-benzodioxol-4-yl)carbamate |
| InChIKey | VGAUUGYGFROFEI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC2=C1OCO2)Cl |
Computed by PubChem (NCBI)