Products 405923-74-2

CAS 405923-74-2 is the registry number for 3-(2-(4-Chloro-2-methylphenoxy)acetamido)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]propanoic acid (CAS 405923-74-2) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 3-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]propanoic acid. InChIKey: UXZJGSFMQOTVTP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClNO4
Molecular weight271.69 g/mol
IUPAC name3-[[2-(4-chloro-2-methylphenoxy)acetyl]amino]propanoic acid
InChIKeyUXZJGSFMQOTVTP-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)Cl)OCC(=O)NCCC(=O)O

Computed by PubChem (NCBI)