CAS 503555-96-2 appears in our catalog under these names: Boc–5–amino–2–chlorobenzoic acid, Boc-5-amino-2-chlorobenzoic acid, Boc-5-amino-2-chlorobenzoic acid, 95%, 5-(Boc-amino)-2-chlorobenzoic acid, 98+% , 5-(TERT-BUTOXYCARBONYLAMINO)-2-CHLOROBENZOIC ACID, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 1g, 5g, 2,5g, 250mg, 500mg, 100mg.
2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 503555-96-2) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: QNRXWUBPCIBQMX-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 2-chloro-5-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | QNRXWUBPCIBQMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)