Products 1183469-43-3
CAS 1183469-43-3 appears in our catalog under these names: 1-(2-Chloro-4-nitrophenoxy)-3,3-dimethylbutan-2-one, 95%, 1-(2-Chloro-4-nitrophenoxy)-3,3-dimethylbutan-2-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-(2-chloro-4-nitrophenoxy)-3,3-dimethylbutan-2-one (CAS 1183469-43-3) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 1-(2-chloro-4-nitrophenoxy)-3,3-dimethylbutan-2-one. InChIKey: YJJVHKPUKRFGJM-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 1-(2-chloro-4-nitrophenoxy)-3,3-dimethylbutan-2-one |
| InChIKey | YJJVHKPUKRFGJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)COC1=C(C=C(C=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)