CAS 232275-73-9 appears in our catalog under these names: Boc-4-amino-2-chlorobenzoic acid, 95%, 4–((tert–Butoxycarbonyl)amino)–2–chlorobenzoic acid, 4-(Boc-amino)-2-chlorobenzoic acid, 97% , 4-{((tert-butoxy)carbonyl)amino}-2-chlorobenzoic acid, 4-((tert-Butoxycarbonyl)amino)-2-chlorobenzoic acid 95%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, Ambeed. Available pack sizes: 5g, 1g, 250mg, 100mg, 2,5g.
2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 232275-73-9) is a chemical compound with the molecular formula C12H14ClNO4 and a molecular weight of 271.69 g/mol. IUPAC name: 2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: HDYBNYDKCZJPPX-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO4 |
|---|---|
| Molecular weight | 271.69 g/mol |
| IUPAC name | 2-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | HDYBNYDKCZJPPX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)