cas: 57365-06-7 — see every product listed under this CAS number, including other names
2-(2-(Bromomethyl)phenyl)isoindoline-1,3-dione, 98+% (CAS 57365-06-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A966733-100mg |
| cas | 57365-06-7 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 747.04 Pln | |
| AmBeed | 10g | 15303.40 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-(bromomethyl)phenyl]isoindole-1,3-dione (CAS 57365-06-7) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: 2-[2-(bromomethyl)phenyl]isoindole-1,3-dione. InChIKey: NRIHZIKJFGRZGX-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 2-[2-(bromomethyl)phenyl]isoindole-1,3-dione |
| InChIKey | NRIHZIKJFGRZGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CBr)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)