CAS 81-50-5 appears in our catalog under these names: 1-Amino-4-bromo-2-methylanthraquinone, 95%, 1-Amino-4-bromo-2-methylanthraquinone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g, 2,5g, 0,25g.
1-amino-4-bromo-2-methylanthracene-9,10-dione (CAS 81-50-5) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: 1-amino-4-bromo-2-methylanthracene-9,10-dione. InChIKey: VIQMJMDPUIBXQO-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 1-amino-4-bromo-2-methylanthracene-9,10-dione |
| InChIKey | VIQMJMDPUIBXQO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1N)C(=O)C3=CC=CC=C3C2=O)Br |
Computed by PubChem (NCBI)