CAS 91713-91-6 appears in our catalog under these names: Bromfenac Lactam, 7-(4-Bromobenzoyl)-1,3-dihydro-2H-indol-2-one, 7-(4-Bromobenzoyl)indolin-2-one (Bromfenac Lactam), 7–(4–Bromobenzoyl)–1,3–dihydro–2H–indol–2–one, AHR 10240 Dimer. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 50mg, 25mg, 1g, 250mg, 250 mg, 1 g.
7-(4-bromobenzoyl)-1,3-dihydroindol-2-one (CAS 91713-91-6) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: 7-(4-bromobenzoyl)-1,3-dihydroindol-2-one. InChIKey: JDSPXIPYMUGSIJ-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 7-(4-bromobenzoyl)-1,3-dihydroindol-2-one |
| InChIKey | JDSPXIPYMUGSIJ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)C(=O)C3=CC=C(C=C3)Br)NC1=O |
Computed by PubChem (NCBI)