CAS 153171-22-3 appears in our catalog under these names: 2-(4-Bromobenzyl)isoindoline-1,3-dione, 95%, 2–(4–Bromobenzyl)isoindoline–1,3–dione, 2-(4-Bromobenzyl)isoindoline-1,3-dione, ≥95%, ≥95%, 2-(4-Bromobenzyl)isoindoline-1,3-dione, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-[(4-bromophenyl)methyl]isoindole-1,3-dione (CAS 153171-22-3) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: 2-[(4-bromophenyl)methyl]isoindole-1,3-dione. InChIKey: OEIUKCOEPYIPFD-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 2-[(4-bromophenyl)methyl]isoindole-1,3-dione |
| InChIKey | OEIUKCOEPYIPFD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)