CAS 128-93-8 appears in our catalog under these names: 1-Bromo-4-(methylamino)anthracene-9,10-dione, 98%, 98%, 1-Bromo-4-(methylamino)anthracene-9,10-dione, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 500g.
1-bromo-4-(methylamino)anthracene-9,10-dione (CAS 128-93-8) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: 1-bromo-4-(methylamino)anthracene-9,10-dione. InChIKey: IIPRUQZTMZETSL-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 1-bromo-4-(methylamino)anthracene-9,10-dione |
| InChIKey | IIPRUQZTMZETSL-UHFFFAOYSA-N |
| SMILES | CNC1=C2C(=C(C=C1)Br)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)