CAS 79183-44-1 appears in our catalog under these names: 1-Benzyl-5-bromoindoline-2,3-dione 97%, 1-Benzyl-5-bromoindoline-2,3-dione, >98.0%(GC), 1-Benzyl-5-bromoindoline-2,3-dione, 97%, 97%, 1-benzyl-5-bromo-1H-indole-2,3-dione, 98%. Offered by: Ambeed, TCI, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-benzyl-5-bromoindole-2,3-dione (CAS 79183-44-1) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: 1-benzyl-5-bromoindole-2,3-dione. InChIKey: GGXZCVYJRFSCPS-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 1-benzyl-5-bromoindole-2,3-dione |
| InChIKey | GGXZCVYJRFSCPS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=C(C=C3)Br)C(=O)C2=O |
Computed by PubChem (NCBI)