CAS 500300-39-0 is the registry number for N–(7–Bromo–9–oxo–9H–fluoren–2–yl)acetamide. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
N-(7-bromo-9-oxofluoren-2-yl)acetamide (CAS 500300-39-0) is a chemical compound with the molecular formula C15H10BrNO2 and a molecular weight of 316.15 g/mol. IUPAC name: N-(7-bromo-9-oxofluoren-2-yl)acetamide. InChIKey: CKPVHGKLBSCMFU-UHFFFAOYSA-N.
| Molecular formula | C15H10BrNO2 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | N-(7-bromo-9-oxofluoren-2-yl)acetamide |
| InChIKey | CKPVHGKLBSCMFU-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC2=C(C=C1)C3=C(C2=O)C=C(C=C3)Br |
Computed by PubChem (NCBI)