cas: 2177266-06-5 — see every product listed under this CAS number, including other names
2-(2-Aminopyridin-4-yl)acetic acid dihydrochloride 98% (CAS 2177266-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1188692-100mg |
| cas | 2177266-06-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 731.94 Pln | |
| Ambeed | 250mg | 1154.69 Pln | |
| Ambeed | 1g | 4286.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1188692 |
2-(2-amino-4-pyridinyl)acetic acid;dihydrochloride (CAS 2177266-06-5) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 2-(2-amino-4-pyridinyl)acetic acid;dihydrochloride. InChIKey: JFAQNGRYLXVJCS-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2-(2-amino-4-pyridinyl)acetic acid;dihydrochloride |
| InChIKey | JFAQNGRYLXVJCS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)