cas: 2177266-06-5 — see every product listed under this CAS number, including other names
2-(2-Aminopyridin-4-yl)acetic acid dihydrochloride, 97% (CAS 2177266-06-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696203-100MG |
| cas | 2177266-06-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 924.69 Pln | |
| Fluorochem | 1g | 3533.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-amino-4-pyridinyl)acetic acid;dihydrochloride (CAS 2177266-06-5) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 2-(2-amino-4-pyridinyl)acetic acid;dihydrochloride. InChIKey: JFAQNGRYLXVJCS-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2-(2-amino-4-pyridinyl)acetic acid;dihydrochloride |
| InChIKey | JFAQNGRYLXVJCS-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1CC(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)