CAS 883514-21-4 appears in our catalog under these names: 5-Bromo-2-fluorophenylacetic acid, 98%, 5-Bromo-2-fluorophenylacetic acid, 5-Bromo-2-fluorophenylacetic Acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 500g.
2-(5-bromo-2-fluorophenyl)acetic acid (CAS 883514-21-4) is a chemical compound with the molecular formula C8H6BrFO2 and a molecular weight of 233.03 g/mol. IUPAC name: 2-(5-bromo-2-fluorophenyl)acetic acid. InChIKey: WSWMCZBGQYAYIS-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO2 |
|---|---|
| Molecular weight | 233.03 g/mol |
| IUPAC name | 2-(5-bromo-2-fluorophenyl)acetic acid |
| InChIKey | WSWMCZBGQYAYIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC(=O)O)F |
Computed by PubChem (NCBI)