cas: 88491-44-5 — see every product listed under this CAS number, including other names
2-(2-Bromo-4-hydroxyphenyl)acetic acid 97% (CAS 88491-44-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A677266-25g |
| cas | 88491-44-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 6427.94 Pln | |
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 348.12 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 1777.69 Pln | |
| Ambeed | 10g | 3251.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A677266 |
2-(2-bromo-4-hydroxyphenyl)acetic acid (CAS 88491-44-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(2-bromo-4-hydroxyphenyl)acetic acid. InChIKey: DYIKUAMKHXANMT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(2-bromo-4-hydroxyphenyl)acetic acid |
| InChIKey | DYIKUAMKHXANMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)CC(=O)O |
Computed by PubChem (NCBI)