cas: 88491-44-5 — see every product listed under this CAS number, including other names
2-(2-Bromo-4-hydroxyphenyl)acetic acid, 96% (CAS 88491-44-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F647992-250MG |
| cas | 88491-44-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 414.46 Pln | |
| Fluorochem | 5g | 1408.90 Pln | |
| Fluorochem | 10g | 2340.86 Pln | |
| Fluorochem | 25g | 4220.41 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
2-(2-bromo-4-hydroxyphenyl)acetic acid (CAS 88491-44-5) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-(2-bromo-4-hydroxyphenyl)acetic acid. InChIKey: DYIKUAMKHXANMT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-(2-bromo-4-hydroxyphenyl)acetic acid |
| InChIKey | DYIKUAMKHXANMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)Br)CC(=O)O |
Computed by PubChem (NCBI)