cas: 85355-50-6 — see every product listed under this CAS number, including other names
2-(2-Bromo-6-nitrophenyl)acetaldehyde 97% (CAS 85355-50-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A564714-250mg |
| cas | 85355-50-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2984.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A564714 |
2-(2-bromo-6-nitrophenyl)acetaldehyde (CAS 85355-50-6) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-(2-bromo-6-nitrophenyl)acetaldehyde. InChIKey: OOKCQYFQNZMYAK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-(2-bromo-6-nitrophenyl)acetaldehyde |
| InChIKey | OOKCQYFQNZMYAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CC=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)