cas: 85355-50-6 — see every product listed under this CAS number, including other names
2-(2-Bromo-6-nitrophenyl)acetaldehyde, 97%, 97% (CAS 85355-50-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IDMX-250mg |
| cas | 85355-50-6 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 419.60 Pln | |
| Chemat | 1g | 942.80 Pln | |
| Chemat | 5g | 3146.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2-bromo-6-nitrophenyl)acetaldehyde (CAS 85355-50-6) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-(2-bromo-6-nitrophenyl)acetaldehyde. InChIKey: OOKCQYFQNZMYAK-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-(2-bromo-6-nitrophenyl)acetaldehyde |
| InChIKey | OOKCQYFQNZMYAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CC=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)