CAS 1340086-28-3 is the registry number for Iguratimod Impurity 40. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloro-5-methoxyphenyl)methanesulfonamide (CAS 1340086-28-3) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: N-(2-chloro-5-methoxyphenyl)methanesulfonamide. InChIKey: YSDWQNWRIRHTFS-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | N-(2-chloro-5-methoxyphenyl)methanesulfonamide |
| InChIKey | YSDWQNWRIRHTFS-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Cl)NS(=O)(=O)C |
Computed by PubChem (NCBI)