Products 95835-17-9
CAS 95835-17-9 appears in our catalog under these names: Tazobactam Impurity V, Tazobactam Acid Impurity 15, Tazobactam Impurity 19. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S,3R,5R)-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (CAS 95835-17-9) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: (2S,3R,5R)-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid. InChIKey: UOLSVGRKGPOWGA-CHKWXVPMSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | (2S,3R,5R)-3-(chloromethyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| InChIKey | UOLSVGRKGPOWGA-CHKWXVPMSA-N |
| SMILES | C[C@@]1([C@@H](N2[C@H](S1)CC2=O)C(=O)O)CCl |
Computed by PubChem (NCBI)
Synonyms:
Tazobactam Impurity V