CAS 721401-51-0 appears in our catalog under these names: Rivaroxaban Impurity 105, Rivaroxaban Impurity 21, 5-Chloro-N-((2S)-2,3-dihydroxypropyl)-2-thiophenecarboxamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
5-chloro-N-[(2S)-2,3-dihydroxypropyl]thiophene-2-carboxamide (CAS 721401-51-0) is a chemical compound with the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. IUPAC name: 5-chloro-N-[(2S)-2,3-dihydroxypropyl]thiophene-2-carboxamide. InChIKey: KPLVWXBCSNCNJA-YFKPBYRVSA-N.
| Molecular formula | C8H10ClNO3S |
|---|---|
| Molecular weight | 235.69 g/mol |
| IUPAC name | 5-chloro-N-[(2S)-2,3-dihydroxypropyl]thiophene-2-carboxamide |
| InChIKey | KPLVWXBCSNCNJA-YFKPBYRVSA-N |
| SMILES | C1=C(SC(=C1)Cl)C(=O)NC[C@@H](CO)O |
Computed by PubChem (NCBI)