cas: 885279-11-8 — see every product listed under this CAS number, including other names
2-(2-Methoxyphenyl)thiazole-4-carbaldehyde, 98%, 98% (CAS 885279-11-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1158AN-100mg |
| cas | 885279-11-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 333.20 Pln | |
| Chemat | 250mg | 530.00 Pln | |
| Chemat | 1g | 1341.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2-methoxyphenyl)-1,3-thiazole-4-carbaldehyde (CAS 885279-11-8) is a chemical compound with the molecular formula C11H9NO2S and a molecular weight of 219.26 g/mol. IUPAC name: 2-(2-methoxyphenyl)-1,3-thiazole-4-carbaldehyde. InChIKey: ZOSOJISOZSLKEH-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-(2-methoxyphenyl)-1,3-thiazole-4-carbaldehyde |
| InChIKey | ZOSOJISOZSLKEH-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=NC(=CS2)C=O |
Computed by PubChem (NCBI)