cas: 154820-99-2 — see every product listed under this CAS number, including other names
2-(3,3-Dimethylbut-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 96%, 96% (CAS 154820-99-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118FQ4-100mg |
| cas | 154820-99-2 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 717.20 Pln | |
| Chemat | 25g | 2488.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-[(E)-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 154820-99-2) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 2-[(E)-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: VTGDQOPDGQPGRO-CMDGGOBGSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 2-[(E)-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | VTGDQOPDGQPGRO-CMDGGOBGSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C(C)(C)C |
Computed by PubChem (NCBI)