Products 165904-16-5
CAS 165904-16-5 is the registry number for (Z)-2-(Hex-3-en-3-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(Z)-hex-3-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 165904-16-5) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 2-[(Z)-hex-3-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZFKZDEBMVVUQNC-MDZDMXLPSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 2-[(Z)-hex-3-en-3-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZFKZDEBMVVUQNC-MDZDMXLPSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C(=C/CC)/CC |
Computed by PubChem (NCBI)