Products 1352747-93-3
CAS 1352747-93-3 is the registry number for (E)-4,4,5,5-Tetramethyl-2-(4-methylpent-1-en-1-yl)-1,3,2-dioxaborolane, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,4,5,5-tetramethyl-2-[(E)-4-methylpent-1-enyl]-1,3,2-dioxaborolane (CAS 1352747-93-3) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(E)-4-methylpent-1-enyl]-1,3,2-dioxaborolane. InChIKey: LYMALJAUPVTKIB-VQHVLOKHSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(E)-4-methylpent-1-enyl]-1,3,2-dioxaborolane |
| InChIKey | LYMALJAUPVTKIB-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CC(C)C |
Computed by PubChem (NCBI)