CAS 2375816-13-8 is the registry number for rel-2-((1R,2R)-2-Isopropylcyclopropyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
4,4,5,5-tetramethyl-2-[(1R,2R)-2-propan-2-ylcyclopropyl]-1,3,2-dioxaborolane (CAS 2375816-13-8) is a chemical compound with the molecular formula C12H23BO2 and a molecular weight of 210.12 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(1R,2R)-2-propan-2-ylcyclopropyl]-1,3,2-dioxaborolane. InChIKey: NGLRCSLJXJGKHV-VHSXEESVSA-N.
| Molecular formula | C12H23BO2 |
|---|---|
| Molecular weight | 210.12 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(1R,2R)-2-propan-2-ylcyclopropyl]-1,3,2-dioxaborolane |
| InChIKey | NGLRCSLJXJGKHV-VHSXEESVSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)[C@@H]2C[C@H]2C(C)C |
Computed by PubChem (NCBI)