cas: 133676-16-1 — see every product listed under this CAS number, including other names
2-(3,4-Dimethoxyphenyl)quinoline-4-carboxylic acid (CAS 133676-16-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014398-250MG |
| cas | 133676-16-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1330.80 Pln | |
| Fluorochem | 1g | 3465.46 Pln | |
| Fluorochem | 5g | 11941.65 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid (CAS 133676-16-1) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid. InChIKey: XJSXKUVHNQWOPH-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | XJSXKUVHNQWOPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O)OC |
Computed by PubChem (NCBI)