CAS 133676-16-1 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)quinoline-4-carboxylic acid, 95%, 2-(3,4-Dimethoxyphenyl)quinoline-4-carboxylic acid, 2-(3,4-Dimethoxyphenyl)quinoline-4-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg.
2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid (CAS 133676-16-1) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid. InChIKey: XJSXKUVHNQWOPH-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)quinoline-4-carboxylic acid |
| InChIKey | XJSXKUVHNQWOPH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NC3=CC=CC=C3C(=C2)C(=O)O)OC |
Computed by PubChem (NCBI)