CAS 1325303-43-2 is the registry number for 3-Benzoyl-6,7-dimethoxy-1,4-dihydroquinolin-4-one, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-benzoyl-6,7-dimethoxy-1H-quinolin-4-one (CAS 1325303-43-2) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: 3-benzoyl-6,7-dimethoxy-1H-quinolin-4-one. InChIKey: BCTBGFHJDISZRS-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 3-benzoyl-6,7-dimethoxy-1H-quinolin-4-one |
| InChIKey | BCTBGFHJDISZRS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=O)C(=CN2)C(=O)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)