Products 1373835-19-8

CAS 1373835-19-8 is the registry number for 6-Benzyloxy-4-hydroxy-quinoline-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-oxo-6-phenylmethoxy-1H-quinoline-2-carboxylate (CAS 1373835-19-8) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: methyl 4-oxo-6-phenylmethoxy-1H-quinoline-2-carboxylate. InChIKey: ISEUSWBMFAUWGC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO4
Molecular weight309.3 g/mol
IUPAC namemethyl 4-oxo-6-phenylmethoxy-1H-quinoline-2-carboxylate
InChIKeyISEUSWBMFAUWGC-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=O)C2=C(N1)C=CC(=C2)OCC3=CC=CC=C3

Computed by PubChem (NCBI)