CAS 226218-61-7 is the registry number for 2,5-dioxopyrrolidin-1-yl 2,2-diphenylacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 2,2-diphenylacetate (CAS 226218-61-7) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2,2-diphenylacetate. InChIKey: SXBXGURRDRCIDJ-UHFFFAOYSA-N.
| Molecular formula | C18H15NO4 |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2,2-diphenylacetate |
| InChIKey | SXBXGURRDRCIDJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)