Products 226218-61-7

CAS 226218-61-7 is the registry number for 2,5-dioxopyrrolidin-1-yl 2,2-diphenylacetate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 2,2-diphenylacetate (CAS 226218-61-7) is a chemical compound with the molecular formula C18H15NO4 and a molecular weight of 309.3 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2,2-diphenylacetate. InChIKey: SXBXGURRDRCIDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC18H15NO4
Molecular weight309.3 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 2,2-diphenylacetate
InChIKeySXBXGURRDRCIDJ-UHFFFAOYSA-N
SMILESC1CC(=O)N(C1=O)OC(=O)C(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)